CAS 82883-32-7 is the registry number for Benzyl β-D-erythrofuranoside. Offered by: Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg.
(2R,3R,4R)-2-phenylmethoxyoxolane-3,4-diol (CAS 82883-32-7) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: (2R,3R,4R)-2-phenylmethoxyoxolane-3,4-diol. InChIKey: MMMYMDKGBKYMJH-GMTAPVOTSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | (2R,3R,4R)-2-phenylmethoxyoxolane-3,4-diol |
| InChIKey | MMMYMDKGBKYMJH-GMTAPVOTSA-N |
| SMILES | C1[C@H]([C@H]([C@@H](O1)OCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)