CAS 828933-86-4 is the registry number for Tolterodine Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-6-methyl-4-phenyl-3,4-dihydro-2H-chromen-2-ol (CAS 828933-86-4) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: (4R)-6-methyl-4-phenyl-3,4-dihydro-2H-chromen-2-ol. InChIKey: JGRSOLBFAHJDTL-JBZHPUCOSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | (4R)-6-methyl-4-phenyl-3,4-dihydro-2H-chromen-2-ol |
| InChIKey | JGRSOLBFAHJDTL-JBZHPUCOSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(C[C@@H]2C3=CC=CC=C3)O |
Computed by PubChem (NCBI)