CAS 83-55-6 appears in our catalog under these names: 5-Amino-1-naphthol, 5–Amino–1–naphthol, 5-Amino-1-naphthol, >97.0%(HPLC)(T), 5-Aminonaphthalen-1-ol 97%, 1-Naphthalenol, 5-amino-, 97%, 97%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 25g, 5g, 10g, 100g, 500g.
5-aminonaphthalen-1-ol (CAS 83-55-6) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 5-aminonaphthalen-1-ol. InChIKey: ZBIBQNVRTVLOHQ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 5-aminonaphthalen-1-ol |
| InChIKey | ZBIBQNVRTVLOHQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2O)C(=C1)N |
Computed by PubChem (NCBI)