CAS 830-94-4 is the registry number for 5-Chlorogramine, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
1-(5-chloro-1H-indol-3-yl)-N,N-dimethylmethanamine (CAS 830-94-4) is a chemical compound with the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. IUPAC name: 1-(5-chloro-1H-indol-3-yl)-N,N-dimethylmethanamine. InChIKey: ILGPJIAGKMKHPE-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2 |
|---|---|
| Molecular weight | 208.69 g/mol |
| IUPAC name | 1-(5-chloro-1H-indol-3-yl)-N,N-dimethylmethanamine |
| InChIKey | ILGPJIAGKMKHPE-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CNC2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)