CAS 83175-02-4 appears in our catalog under these names: Ethyl 1,3-dimethylorotate, 95%, Ethyl 1,3–dimethylorotate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ethyl 1,3-dimethyl-2,6-dioxopyrimidine-4-carboxylate (CAS 83175-02-4) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: ethyl 1,3-dimethyl-2,6-dioxopyrimidine-4-carboxylate. InChIKey: PPASXNXFADOELD-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | ethyl 1,3-dimethyl-2,6-dioxopyrimidine-4-carboxylate |
| InChIKey | PPASXNXFADOELD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=O)N(C(=O)N1C)C |
Computed by PubChem (NCBI)