CAS 83178-70-5 appears in our catalog under these names: 3-(5-Oxo-2-thioxoimidazolidin-4-yl)propanoic acid, 95+%, 95+%, 3-(5-Oxo-2-thioxoimidazolidin-4-yl)propanoic acid, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g.
3-(5-oxo-2-sulfanylideneimidazolidin-4-yl)propanoic acid (CAS 83178-70-5) is a chemical compound with the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. IUPAC name: 3-(5-oxo-2-sulfanylideneimidazolidin-4-yl)propanoic acid. InChIKey: KUXWRHDAVRASKI-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O3S |
|---|---|
| Molecular weight | 188.21 g/mol |
| IUPAC name | 3-(5-oxo-2-sulfanylideneimidazolidin-4-yl)propanoic acid |
| InChIKey | KUXWRHDAVRASKI-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)C1C(=O)NC(=S)N1 |
Computed by PubChem (NCBI)