Products 83194-75-6

CAS 83194-75-6 is the registry number for Methyl 2,6-dimethyl-4-oxocyclohexanecarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2,6-dimethyl-4-oxocyclohexane-1-carboxylate (CAS 83194-75-6) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: methyl 2,6-dimethyl-4-oxocyclohexane-1-carboxylate. InChIKey: ZFTBABDQSARKFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O3
Molecular weight184.23 g/mol
IUPAC namemethyl 2,6-dimethyl-4-oxocyclohexane-1-carboxylate
InChIKeyZFTBABDQSARKFJ-UHFFFAOYSA-N
SMILESCC1CC(=O)CC(C1C(=O)OC)C

Computed by PubChem (NCBI)