Products 83393-23-1
CAS 83393-23-1 appears in our catalog under these names: 8-Benzyl-8-azabicyclo[3.2.1]octan-3-one hydrochloride, 97+%, 97+%, 8-Benzyl-8-azabicyclo[3.2.1]octan-3-onehydrochloride, 97+%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g.
(1S,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-one;hydrochloride (CAS 83393-23-1) is a chemical compound with the molecular formula C14H18ClNO and a molecular weight of 251.75 g/mol. IUPAC name: (1S,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-one;hydrochloride. InChIKey: XPIPTYACPFJRQB-OEEJBDNKSA-N.
| Molecular formula | C14H18ClNO |
|---|---|
| Molecular weight | 251.75 g/mol |
| IUPAC name | (1S,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-one;hydrochloride |
| InChIKey | XPIPTYACPFJRQB-OEEJBDNKSA-N |
| SMILES | C1C[C@H]2CC(=O)C[C@@H]1N2CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)