Products 83414-50-0
CAS 83414-50-0 is the registry number for 6-(Naphthalen-2-yloxy)pyridin-3-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg.
6-naphthalen-2-yloxypyridin-3-amine (CAS 83414-50-0) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 6-naphthalen-2-yloxypyridin-3-amine. InChIKey: QVEMGQSEKKURHQ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 6-naphthalen-2-yloxypyridin-3-amine |
| InChIKey | QVEMGQSEKKURHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)OC3=NC=C(C=C3)N |
Computed by PubChem (NCBI)