CAS 835876-08-9 is the registry number for 6'-Methoxy-[2,3'-bipyridin]-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(6-methoxy-3-pyridinyl)pyridin-3-amine (CAS 835876-08-9) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: 6-(6-methoxy-3-pyridinyl)pyridin-3-amine. InChIKey: SPGQGMOAWKVHIQ-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 6-(6-methoxy-3-pyridinyl)pyridin-3-amine |
| InChIKey | SPGQGMOAWKVHIQ-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)