CAS 835879-06-6 appears in our catalog under these names: 2-Amino-5-(4-methylpiperazin-1-yl)benzoic acid, 2-amino-5-(4-methylpiperazin-1-yl)benzoic acid, ≥95%, ≥95%, 2-Amino-5-(4-methylpiperazin-1-yl)benzoic acid, ≥95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g, 10g.
2-amino-5-(4-methylpiperazin-1-yl)benzoic acid (CAS 835879-06-6) is a chemical compound with the molecular formula C12H17N3O2 and a molecular weight of 235.28 g/mol. IUPAC name: 2-amino-5-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: JFANXMJCQYGAIG-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O2 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 2-amino-5-(4-methylpiperazin-1-yl)benzoic acid |
| InChIKey | JFANXMJCQYGAIG-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)N)C(=O)O |
Computed by PubChem (NCBI)