CAS 83631-55-4 is the registry number for 5-Phenyl-2,3-dihydro-1,3-thiazol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-phenyl-3H-1,3-thiazol-2-one (CAS 83631-55-4) is a chemical compound with the molecular formula C9H7NOS and a molecular weight of 177.22 g/mol. IUPAC name: 5-phenyl-3H-1,3-thiazol-2-one. InChIKey: JGLDQLVRYJRBBW-UHFFFAOYSA-N.
| Molecular formula | C9H7NOS |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 5-phenyl-3H-1,3-thiazol-2-one |
| InChIKey | JGLDQLVRYJRBBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CNC(=O)S2 |
Computed by PubChem (NCBI)