CAS 83780-47-6 is the registry number for (R)-Chroman-2-carboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
(2R)-3,4-dihydro-2H-chromene-2-carboxylic acid (CAS 83780-47-6) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (2R)-3,4-dihydro-2H-chromene-2-carboxylic acid. InChIKey: SFLFCQJQOIZMHF-SECBINFHSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (2R)-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChIKey | SFLFCQJQOIZMHF-SECBINFHSA-N |
| SMILES | C1CC2=CC=CC=C2O[C@H]1C(=O)O |
Computed by PubChem (NCBI)