CAS 838892-98-1 is the registry number for (2-Phenyl-1,3-oxazol-5-yl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2-phenyl-1,3-oxazol-5-yl)methanamine (CAS 838892-98-1) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: (2-phenyl-1,3-oxazol-5-yl)methanamine. InChIKey: YSIWUHZRXBCISV-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (2-phenyl-1,3-oxazol-5-yl)methanamine |
| InChIKey | YSIWUHZRXBCISV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(O2)CN |
Computed by PubChem (NCBI)