Products 83909-35-7

CAS 83909-35-7 is the registry number for Methyl 5-amino-2-morpholinobenzoate dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 5-amino-2-morpholin-4-ylbenzoate (CAS 83909-35-7) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: methyl 5-amino-2-morpholin-4-ylbenzoate. InChIKey: UDCGGVAQNYMTAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16N2O3
Molecular weight236.27 g/mol
IUPAC namemethyl 5-amino-2-morpholin-4-ylbenzoate
InChIKeyUDCGGVAQNYMTAZ-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC(=C1)N)N2CCOCC2

Computed by PubChem (NCBI)