Products 83960-22-9

CAS 83960-22-9 is the registry number for Thiorphan Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 2-[(2-benzyl-3-sulfanylpropanoyl)amino]acetate (CAS 83960-22-9) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. IUPAC name: methyl 2-[(2-benzyl-3-sulfanylpropanoyl)amino]acetate. InChIKey: NWBHIAPUIJHFGB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO3S
Molecular weight267.35 g/mol
IUPAC namemethyl 2-[(2-benzyl-3-sulfanylpropanoyl)amino]acetate
InChIKeyNWBHIAPUIJHFGB-UHFFFAOYSA-N
SMILESCOC(=O)CNC(=O)C(CC1=CC=CC=C1)CS

Computed by PubChem (NCBI)