Products 83988-97-0
CAS 83988-97-0 is the registry number for Neuroinflammatory-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(2E,6E)-3,7,11-trimethyl-10-oxododeca-2,6-dienoxy]chromen-2-one (CAS 83988-97-0) is a chemical compound with the molecular formula C24H30O4 and a molecular weight of 382.5 g/mol. IUPAC name: 7-[(2E,6E)-3,7,11-trimethyl-10-oxododeca-2,6-dienoxy]chromen-2-one. InChIKey: FOLRRJWXMGCSSH-BGOJXZSCSA-N.
| Molecular formula | C24H30O4 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 7-[(2E,6E)-3,7,11-trimethyl-10-oxododeca-2,6-dienoxy]chromen-2-one |
| InChIKey | FOLRRJWXMGCSSH-BGOJXZSCSA-N |
| SMILES | CC(C)C(=O)CC/C(=C/CC/C(=C/COC1=CC2=C(C=C1)C=CC(=O)O2)/C)/C |
Computed by PubChem (NCBI)
Synonyms:
Neuroinflammatory-IN-1, orb1943081