Products 84-78-6
CAS 84-78-6 appears in our catalog under these names: Phthalic acid, butyloctyl ester, Butyl octyl phthalate 95%, Butyl octyl phthalate, 95%, 95%, butyl octyl phthalate, 95%. Offered by: Dr. Ehrenstorfer, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
1-O-butyl 2-O-octyl benzene-1,2-dicarboxylate (CAS 84-78-6) is a chemical compound with the molecular formula C20H30O4 and a molecular weight of 334.4 g/mol. IUPAC name: 1-O-butyl 2-O-octyl benzene-1,2-dicarboxylate. InChIKey: MURWRBWZIMXKGC-UHFFFAOYSA-N.
| Molecular formula | C20H30O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 1-O-butyl 2-O-octyl benzene-1,2-dicarboxylate |
| InChIKey | MURWRBWZIMXKGC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC |
Computed by PubChem (NCBI)