CAS 841302-25-8 is the registry number for Des-cyclopropyl Saxagliptin. Offered by: TRC. Available pack sizes: 25mg.
(2S)-1-[(2S)-2-amino-2-(3-hydroxy-1-adamantyl)acetyl]pyrrolidine-2-carbonitrile (CAS 841302-25-8) is a chemical compound with the molecular formula C17H25N3O2 and a molecular weight of 303.4 g/mol. IUPAC name: (2S)-1-[(2S)-2-amino-2-(3-hydroxy-1-adamantyl)acetyl]pyrrolidine-2-carbonitrile. InChIKey: OHUOCCZGTKZOSF-GKNBTTNJSA-N.
| Molecular formula | C17H25N3O2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-amino-2-(3-hydroxy-1-adamantyl)acetyl]pyrrolidine-2-carbonitrile |
| InChIKey | OHUOCCZGTKZOSF-GKNBTTNJSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)[C@H](C23CC4CC(C2)CC(C4)(C3)O)N)C#N |
Computed by PubChem (NCBI)