CAS 84133-32-4 is the registry number for Methyl 1-(pyridin-3-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-pyridin-3-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (CAS 84133-32-4) is a chemical compound with the molecular formula C18H17N3O2 and a molecular weight of 307.3 g/mol. IUPAC name: methyl 1-pyridin-3-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: VOMJKYKNVFYOMS-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O2 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | methyl 1-pyridin-3-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | VOMJKYKNVFYOMS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C(N1)C3=CN=CC=C3)NC4=CC=CC=C24 |
Computed by PubChem (NCBI)