CAS 842123-78-8 is the registry number for 4-(3,5-Dimethylphenyl)-1-buten-4-ol, 98% +(stabilized with TBC). Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,5-dimethylphenyl)but-3-en-1-ol (CAS 842123-78-8) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)but-3-en-1-ol. InChIKey: ONIRIVZVMDNXGK-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)but-3-en-1-ol |
| InChIKey | ONIRIVZVMDNXGK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(CC=C)O)C |
Computed by PubChem (NCBI)