Products 84271-84-1
CAS 84271-84-1 is the registry number for 2-(4-tert-Butylphenyl)-2-methylpropanenitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(4-tert-butylphenyl)-2-methylpropanenitrile (CAS 84271-84-1) is a chemical compound with the molecular formula C14H19N and a molecular weight of 201.31 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-2-methylpropanenitrile. InChIKey: XYGURMFNVKMOLN-UHFFFAOYSA-N.
| Molecular formula | C14H19N |
|---|---|
| Molecular weight | 201.31 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-2-methylpropanenitrile |
| InChIKey | XYGURMFNVKMOLN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C)(C)C#N |
Computed by PubChem (NCBI)