CAS 842954-77-2 appears in our catalog under these names: 5-Methyl-3-phenyl-4,5-dihydroisoxazole-5-carboxylic acid, 95%, 5-Methyl-3-phenyl-4,5-dihydroisoxazole-5-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-methyl-3-phenyl-4H-1,2-oxazole-5-carboxylic acid (CAS 842954-77-2) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 5-methyl-3-phenyl-4H-1,2-oxazole-5-carboxylic acid. InChIKey: HHSXXVCKNAZBGR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 5-methyl-3-phenyl-4H-1,2-oxazole-5-carboxylic acid |
| InChIKey | HHSXXVCKNAZBGR-UHFFFAOYSA-N |
| SMILES | CC1(CC(=NO1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)