Products 842975-51-3
CAS 842975-51-3 is the registry number for 2-(8-Oxo-5,6,7,8-tetrahydro-1H-cyclopenta[d][1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-11-yl)acetic acid (CAS 842975-51-3) is a chemical compound with the molecular formula C10H10N4O3 and a molecular weight of 234.21 g/mol. IUPAC name: 2-(2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-11-yl)acetic acid. InChIKey: VASLRFCMUQFHCX-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O3 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 2-(2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-11-yl)acetic acid |
| InChIKey | VASLRFCMUQFHCX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N=C3N=C(NN3C2=O)CC(=O)O |
Computed by PubChem (NCBI)