CAS 42867-68-5 appears in our catalog under these names: Didanosine EP Impurity F, 2',3'-Dideoxy-2',3'-didehydroinosine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 100mg, 500mg, 1000mg, 2000mg.
9-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1H-purin-6-one (CAS 42867-68-5) is a chemical compound with the molecular formula C10H10N4O3 and a molecular weight of 234.21 g/mol. IUPAC name: 9-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1H-purin-6-one. InChIKey: TYQPBHYPIRLWKU-NKWVEPMBSA-N.
| Molecular formula | C10H10N4O3 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 9-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-1H-purin-6-one |
| InChIKey | TYQPBHYPIRLWKU-NKWVEPMBSA-N |
| SMILES | C1=C[C@@H](O[C@@H]1CO)N2C=NC3=C2N=CNC3=O |
Computed by PubChem (NCBI)