CAS 1304825-93-1 is the registry number for N-((5-Methylisoxazol-3-yl)methyl)-5-nitropyridin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyridin-2-amine (CAS 1304825-93-1) is a chemical compound with the molecular formula C10H10N4O3 and a molecular weight of 234.21 g/mol. IUPAC name: N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyridin-2-amine. InChIKey: KYXPKDLRAJQGSW-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O3 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitropyridin-2-amine |
| InChIKey | KYXPKDLRAJQGSW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)CNC2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)