CAS 832739-85-2 is the registry number for 2-[3-(1h-1,2,3,4-tetrazol-1-yl)phenoxy]propanoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g.
2-[3-(tetrazol-1-yl)phenoxy]propanoic acid (CAS 832739-85-2) is a chemical compound with the molecular formula C10H10N4O3 and a molecular weight of 234.21 g/mol. IUPAC name: 2-[3-(tetrazol-1-yl)phenoxy]propanoic acid. InChIKey: GXJLZCCLIHGQPW-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O3 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 2-[3-(tetrazol-1-yl)phenoxy]propanoic acid |
| InChIKey | GXJLZCCLIHGQPW-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=CC(=C1)N2C=NN=N2 |
Computed by PubChem (NCBI)