Products 832739-85-2

CAS 832739-85-2 is the registry number for 2-[3-(1h-1,2,3,4-tetrazol-1-yl)phenoxy]propanoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2-[3-(tetrazol-1-yl)phenoxy]propanoic acid (CAS 832739-85-2) is a chemical compound with the molecular formula C10H10N4O3 and a molecular weight of 234.21 g/mol. IUPAC name: 2-[3-(tetrazol-1-yl)phenoxy]propanoic acid. InChIKey: GXJLZCCLIHGQPW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N4O3
Molecular weight234.21 g/mol
IUPAC name2-[3-(tetrazol-1-yl)phenoxy]propanoic acid
InChIKeyGXJLZCCLIHGQPW-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=CC=CC(=C1)N2C=NN=N2

Computed by PubChem (NCBI)