Products 842977-00-8

CAS 842977-00-8 is the registry number for 3-(3,5-Dimethyl-[1,2,4]triazol-1-yl)-2-methyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylpropanoic acid (CAS 842977-00-8) is a chemical compound with the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. IUPAC name: 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylpropanoic acid. InChIKey: XQMOIKPHHLOTEA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13N3O2
Molecular weight183.21 g/mol
IUPAC name3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylpropanoic acid
InChIKeyXQMOIKPHHLOTEA-UHFFFAOYSA-N
SMILESCC1=NN(C(=N1)C)CC(C)C(=O)O

Computed by PubChem (NCBI)