CAS 842977-00-8 is the registry number for 3-(3,5-Dimethyl-[1,2,4]triazol-1-yl)-2-methyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylpropanoic acid (CAS 842977-00-8) is a chemical compound with the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. IUPAC name: 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylpropanoic acid. InChIKey: XQMOIKPHHLOTEA-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylpropanoic acid |
| InChIKey | XQMOIKPHHLOTEA-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)C)CC(C)C(=O)O |
Computed by PubChem (NCBI)