CAS 84324-66-3 is the registry number for 2,4-Difluoro-N-(pyridin-3-ylmethyl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,4-difluoro-N-(pyridin-3-ylmethyl)aniline (CAS 84324-66-3) is a chemical compound with the molecular formula C12H10F2N2 and a molecular weight of 220.22 g/mol. IUPAC name: 2,4-difluoro-N-(pyridin-3-ylmethyl)aniline. InChIKey: LDRSQLVXBAGLIR-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2,4-difluoro-N-(pyridin-3-ylmethyl)aniline |
| InChIKey | LDRSQLVXBAGLIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)