Products 84392-22-3
CAS 84392-22-3 is the registry number for 2-([1,1':4',1''-Terphenyl]-2-yl)-4,4-Dimethyl-4,5-dihydrooxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4-dimethyl-2-[2-(4-phenylphenyl)phenyl]-5H-1,3-oxazole (CAS 84392-22-3) is a chemical compound with the molecular formula C23H21NO and a molecular weight of 327.4 g/mol. IUPAC name: 4,4-dimethyl-2-[2-(4-phenylphenyl)phenyl]-5H-1,3-oxazole. InChIKey: OTAMECKQPBQAAU-UHFFFAOYSA-N.
| Molecular formula | C23H21NO |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4,4-dimethyl-2-[2-(4-phenylphenyl)phenyl]-5H-1,3-oxazole |
| InChIKey | OTAMECKQPBQAAU-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=CC=CC=C2C3=CC=C(C=C3)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)