CAS 275371-79-4 appears in our catalog under these names: 2-Methyl-n-(triphenylmethyl)-2-propenamide, 95%, N-Tritylmethacrylamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
2-methyl-N-tritylprop-2-enamide (CAS 275371-79-4) is a chemical compound with the molecular formula C23H21NO and a molecular weight of 327.4 g/mol. IUPAC name: 2-methyl-N-tritylprop-2-enamide. InChIKey: UTYRFBWBJRYRSO-UHFFFAOYSA-N.
| Molecular formula | C23H21NO |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 2-methyl-N-tritylprop-2-enamide |
| InChIKey | UTYRFBWBJRYRSO-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)