Products 1528793-12-5
CAS 1528793-12-5 appears in our catalog under these names: JWH 073 N–(2–methylpropyl) isomer, 3-(1-Naphthoyl)-1-isobutyl-1H-indole. Offered by: GLPBio, Biosynth. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg.
[1-(2-methylpropyl)indol-3-yl]-naphthalen-1-ylmethanone (CAS 1528793-12-5) is a chemical compound with the molecular formula C23H21NO and a molecular weight of 327.4 g/mol. IUPAC name: [1-(2-methylpropyl)indol-3-yl]-naphthalen-1-ylmethanone. InChIKey: XNFHBVYEKFAQLX-UHFFFAOYSA-N.
| Molecular formula | C23H21NO |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | [1-(2-methylpropyl)indol-3-yl]-naphthalen-1-ylmethanone |
| InChIKey | XNFHBVYEKFAQLX-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)