CAS 1415744-43-2 appears in our catalog under these names: (1-(butyl-2,2,3,3,4,4,4-d7)-1H-indol-3-yl)(naphthalen-1-yl)methanone, >95% (HPLC), JWH 073-d7. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 5mg, 25mg.
[1-(2,2,3,3,4,4,4-heptadeuteriobutyl)indol-3-yl]-naphthalen-1-ylmethanone (CAS 1415744-43-2) is a chemical compound with the molecular formula C23H21NO and a molecular weight of 334.5 g/mol. IUPAC name: [1-(2,2,3,3,4,4,4-heptadeuteriobutyl)indol-3-yl]-naphthalen-1-ylmethanone. InChIKey: VCHHHSMPMLNVGS-NCKGIQLSSA-N.
| Molecular formula | C23H21NO |
|---|---|
| Molecular weight | 334.5 g/mol |
| IUPAC name | [1-(2,2,3,3,4,4,4-heptadeuteriobutyl)indol-3-yl]-naphthalen-1-ylmethanone |
| InChIKey | VCHHHSMPMLNVGS-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])CN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)