CAS 84478-76-2 appears in our catalog under these names: 2–Chloro–4–fluoro–5–nitroanisole, 1-Chloro-5-fluoro-2-methoxy-4-nitrobenzene 97%, 1-Chloro-5-fluoro-2-methoxy-4-nitrobenzene, 97%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 25g, 100g, 10g.
1-chloro-5-fluoro-2-methoxy-4-nitrobenzene (CAS 84478-76-2) is a chemical compound with the molecular formula C7H5ClFNO3 and a molecular weight of 205.57 g/mol. IUPAC name: 1-chloro-5-fluoro-2-methoxy-4-nitrobenzene. InChIKey: CRONHBXGPYQWHX-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO3 |
|---|---|
| Molecular weight | 205.57 g/mol |
| IUPAC name | 1-chloro-5-fluoro-2-methoxy-4-nitrobenzene |
| InChIKey | CRONHBXGPYQWHX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])F)Cl |
Computed by PubChem (NCBI)