CAS 84496-85-5 is the registry number for Clomeprop (free acid). Offered by: Dr. Ehrenstorfer, Biosynth. Available pack sizes: 25mg, 250mg.
2-(2,4-dichloro-3-methylphenoxy)propanoic acid (CAS 84496-85-5) is a chemical compound with the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. IUPAC name: 2-(2,4-dichloro-3-methylphenoxy)propanoic acid. InChIKey: PCKKAQFQKHNBJH-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O3 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 2-(2,4-dichloro-3-methylphenoxy)propanoic acid |
| InChIKey | PCKKAQFQKHNBJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)OC(C)C(=O)O)Cl |
Computed by PubChem (NCBI)