Products 854181-94-5

CAS 854181-94-5 is the registry number for 1-(4-methylphenyl)ethanamine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.

Structural formula: {0} (CAS {1})

1-(4-methylphenyl)ethanamine;hydrochloride (CAS 854181-94-5) is a chemical compound with the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. IUPAC name: 1-(4-methylphenyl)ethanamine;hydrochloride. InChIKey: QDWBCLYSNFCQGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14ClN
Molecular weight171.67 g/mol
IUPAC name1-(4-methylphenyl)ethanamine;hydrochloride
InChIKeyQDWBCLYSNFCQGQ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C(C)N.Cl

Computed by PubChem (NCBI)