Products 845626-56-4
CAS 845626-56-4 is the registry number for 3-Methoxy-5-(trifluoromethoxy)aniline, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
3-methoxy-5-(trifluoromethoxy)aniline (CAS 845626-56-4) is a chemical compound with the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. IUPAC name: 3-methoxy-5-(trifluoromethoxy)aniline. InChIKey: WNXRSXDGYMBXSX-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO2 |
|---|---|
| Molecular weight | 207.15 g/mol |
| IUPAC name | 3-methoxy-5-(trifluoromethoxy)aniline |
| InChIKey | WNXRSXDGYMBXSX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)N)OC(F)(F)F |
Computed by PubChem (NCBI)