CAS 846035-09-4 is the registry number for 7-Chloro-3-methyl-2-(phenylmethoxy)-1,8-naphthyridine. Offered by: TRC. Available pack sizes: 500mg.
7-chloro-3-methyl-2-phenylmethoxy-1,8-naphthyridine (CAS 846035-09-4) is a chemical compound with the molecular formula C16H13ClN2O and a molecular weight of 284.74 g/mol. IUPAC name: 7-chloro-3-methyl-2-phenylmethoxy-1,8-naphthyridine. InChIKey: NDSMNEJDBIMWLL-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | 7-chloro-3-methyl-2-phenylmethoxy-1,8-naphthyridine |
| InChIKey | NDSMNEJDBIMWLL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C(C=C2)Cl)N=C1OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)