Products 846048-15-5
CAS 846048-15-5 appears in our catalog under these names: 5-Bromo-1,2-dihydro-1-methyl-2-oxo-nicotinic acid, 98%, 5-bromo-1,2-dihydro-1-methyl-2-oxo-nicotinic acid, 5-Bromo-1-methyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 2,5g, 100mg, 25g.
5-bromo-1-methyl-2-oxopyridine-3-carboxylic acid (CAS 846048-15-5) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 5-bromo-1-methyl-2-oxopyridine-3-carboxylic acid. InChIKey: RKLHARUABHWIDP-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 5-bromo-1-methyl-2-oxopyridine-3-carboxylic acid |
| InChIKey | RKLHARUABHWIDP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C(C1=O)C(=O)O)Br |
Computed by PubChem (NCBI)