CAS 84703-17-3 appears in our catalog under these names: 2,5-Dichloro-6-methylnicotinonitrile 97%, 2,5-Dichloro-6-methylnicotinonitrile, 98%, 98%, 2,5-Dichloro-6-methylnicotinonitrile, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,5-dichloro-6-methylpyridine-3-carbonitrile (CAS 84703-17-3) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 2,5-dichloro-6-methylpyridine-3-carbonitrile. InChIKey: WNNMMPADSQWJTO-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 2,5-dichloro-6-methylpyridine-3-carbonitrile |
| InChIKey | WNNMMPADSQWJTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=N1)Cl)C#N)Cl |
Computed by PubChem (NCBI)