CAS 847035-46-5 is the registry number for 4-{((Furan-2-yl)methyl)amino}-1,2-dihydropyrimidin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-(furan-2-ylmethylamino)-1H-pyrimidin-2-one (CAS 847035-46-5) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 6-(furan-2-ylmethylamino)-1H-pyrimidin-2-one. InChIKey: PPZNKEWLJJEHRV-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 6-(furan-2-ylmethylamino)-1H-pyrimidin-2-one |
| InChIKey | PPZNKEWLJJEHRV-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=CC=NC(=O)N2 |
Computed by PubChem (NCBI)