CAS 847996-52-5 is the registry number for (±)-N-Methyldesethylreboxetine. Offered by: TRC. Available pack sizes: 250mg.
2-[(S)-[(2S)-4-methylmorpholin-2-yl]-phenylmethoxy]phenol (CAS 847996-52-5) is a chemical compound with the molecular formula C18H21NO3 and a molecular weight of 299.4 g/mol. IUPAC name: 2-[(S)-[(2S)-4-methylmorpholin-2-yl]-phenylmethoxy]phenol. InChIKey: FZTOQQDBNKVFCW-ROUUACIJSA-N.
| Molecular formula | C18H21NO3 |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | 2-[(S)-[(2S)-4-methylmorpholin-2-yl]-phenylmethoxy]phenol |
| InChIKey | FZTOQQDBNKVFCW-ROUUACIJSA-N |
| SMILES | CN1CCO[C@@H](C1)[C@H](C2=CC=CC=C2)OC3=CC=CC=C3O |
Computed by PubChem (NCBI)