CAS 84833-61-4 is the registry number for 1-(4-Chlorophenyl)cyclopentanecarboxamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(4-chlorophenyl)cyclopentane-1-carboxamide (CAS 84833-61-4) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclopentane-1-carboxamide. InChIKey: VNFVJAGKRQIORD-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclopentane-1-carboxamide |
| InChIKey | VNFVJAGKRQIORD-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)N |
Computed by PubChem (NCBI)