Products 848420-59-7
CAS 848420-59-7 is the registry number for (R)-1-Boc-5-isopropylpyrrolidine-2,4-dione, >95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (2R)-3,5-dioxo-2-propan-2-ylpyrrolidine-1-carboxylate (CAS 848420-59-7) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: tert-butyl (2R)-3,5-dioxo-2-propan-2-ylpyrrolidine-1-carboxylate. InChIKey: CZMQMVKDVCGJPG-SNVBAGLBSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | tert-butyl (2R)-3,5-dioxo-2-propan-2-ylpyrrolidine-1-carboxylate |
| InChIKey | CZMQMVKDVCGJPG-SNVBAGLBSA-N |
| SMILES | CC(C)[C@@H]1C(=O)CC(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)