CAS 848444-88-2 appears in our catalog under these names: 1–tert–Butyl 2–methyl 3,3–dimethyl–4–oxopyrrolidine–1,2–dicarboxylate, 1-tert-butyl 2-methyl 3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate, 95%, 95%, 1-TERT-BUTYL 2-METHYL 3,3-DIMETHYL-4-OXOPYRROLIDINE-1,2-DICARBOXYLATE, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-O-tert-butyl 2-O-methyl 3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate (CAS 848444-88-2) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: YBHLDAHDAOFWGW-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | YBHLDAHDAOFWGW-UHFFFAOYSA-N |
| SMILES | CC1(C(N(CC1=O)C(=O)OC(C)(C)C)C(=O)OC)C |
Computed by PubChem (NCBI)