CAS 848814-02-8 is the registry number for 2-Iodo-5-methyl-4-nitro-phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-iodo-5-methyl-4-nitrophenol (CAS 848814-02-8) is a chemical compound with the molecular formula C7H6INO3 and a molecular weight of 279.03 g/mol. IUPAC name: 2-iodo-5-methyl-4-nitrophenol. InChIKey: SUBUJCUCAVAKTM-UHFFFAOYSA-N.
| Molecular formula | C7H6INO3 |
|---|---|
| Molecular weight | 279.03 g/mol |
| IUPAC name | 2-iodo-5-methyl-4-nitrophenol |
| InChIKey | SUBUJCUCAVAKTM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])I)O |
Computed by PubChem (NCBI)