CAS 849020-87-7 appears in our catalog under these names: 6-oxo-4-(trifluoromethyl)-1,6-dihydropyridine-3-carboxylic acid, 95%, 95%, 6-Hydroxy-4-(trifluoromethyl)nicotinic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g.
6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxylic acid (CAS 849020-87-7) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxylic acid. InChIKey: WCUKVMMGYGOCGJ-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxylic acid |
| InChIKey | WCUKVMMGYGOCGJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CNC1=O)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)