Products 849062-33-5
CAS 849062-33-5 appears in our catalog under these names: 3–(3'–Chlorobenzyloxy)phenylboronic acid(contains varying amounts of Anhydride), (3-((3-Chlorobenzyl)oxy)phenyl)boronic acid, 95%, 3-(3'-Chlorobenzyloxy)phenylboronic acid, 95%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 250mg, 5g, 100mg.
[3-[(3-chlorophenyl)methoxy]phenyl]boronic acid (CAS 849062-33-5) is a chemical compound with the molecular formula C13H12BClO3 and a molecular weight of 262.50 g/mol. IUPAC name: [3-[(3-chlorophenyl)methoxy]phenyl]boronic acid. InChIKey: ZSNYOIJMFZLJES-UHFFFAOYSA-N.
| Molecular formula | C13H12BClO3 |
|---|---|
| Molecular weight | 262.50 g/mol |
| IUPAC name | [3-[(3-chlorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | ZSNYOIJMFZLJES-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=CC(=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(3'-Chlorobenzyloxy)phenylboronic acid, (3-((3-Chlorobenzyl)oxy)phenyl)boronic acid, [3-[(3-chlorophenyl)methoxy]phenyl]boronic acid, {3-[(3-Chlorophenyl)methoxy]phenyl}boronic acid, 3-[(3-Chlorobenzyl)oxy]phenylboronic Acid, (3-((3-Chlorobenzyl)oxy)phenyl)boronicacid, 3-(3'-Chlorobenzyloxy)phenylboronic acid(contains varying amounts of Anhydride)