CAS 849354-84-3 appears in our catalog under these names: Des-Furan Furalaxyl, Benalaxyl metabolite F4. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 10mg.
Methyl 2-(N-formyl-2,6-dimethylanilino)propanoate (CAS 849354-84-3) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: methyl 2-(N-formyl-2,6-dimethylanilino)propanoate. InChIKey: OEZMABDASOQWPD-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | methyl 2-(N-formyl-2,6-dimethylanilino)propanoate |
| InChIKey | OEZMABDASOQWPD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N(C=O)C(C)C(=O)OC |
Computed by PubChem (NCBI)