CAS 84944-41-2 is the registry number for 2-(Carboxymethyl)-3-methylbenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(carboxymethyl)-3-methylbenzoic acid (CAS 84944-41-2) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-(carboxymethyl)-3-methylbenzoic acid. InChIKey: ZCPDETLIGYLUHS-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-(carboxymethyl)-3-methylbenzoic acid |
| InChIKey | ZCPDETLIGYLUHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)